C16H22 — CID 144535751
1-ethyl-2-[(2Z,4Z)-4-ethylhexa-2,4-dien-3-yl]benzene (PubChem CID 144535751) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-ethyl-2-[(2Z,4Z)-4-ethylhexa-2,4-dien-3-yl]benzene.
| Compound Name | 1-ethyl-2-[(2Z,4Z)-4-ethylhexa-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 144535751 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-ethyl-2-[(2Z,4Z)-4-ethylhexa-2,4-dien-3-yl]benzene |
| SMILES | C/C=C(CC)\C(=C\C)c1ccccc1CC |
| InChI | InChI=1S/C16H22/c1-5-13(6-2)15(8-4)16-12-10-9-11-14(16)7-3/h5,8-12H,6-7H2,1-4H3/b13-5-,15-8- |
| InChIKey | GHZWKADPCARMAK-OPZOBIAHSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|