C24H28 — CID 142906504
1-ethyl-2-[(1E,3E,5Z)-3-ethylidene-1-(3-methylphenyl)hepta-1,5-dien-2-yl]benzene (PubChem CID 142906504) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-ethyl-2-[(1E,3E,5Z)-3-ethylidene-1-(3-methylphenyl)hepta-1,5-dien-2-yl]benzene.
| Compound Name | 1-ethyl-2-[(1E,3E,5Z)-3-ethylidene-1-(3-methylphenyl)hepta-1,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 142906504 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-ethyl-2-[(1E,3E,5Z)-3-ethylidene-1-(3-methylphenyl)hepta-1,5-dien-2-yl]benzene |
| SMILES | C/C=C\CC(=C\C)/C(=C\c1cccc(C)c1)c1ccccc1CC |
| InChI | InChI=1S/C24H28/c1-5-8-14-22(7-3)24(18-20-13-11-12-19(4)17-20)23-16-10-9-15-21(23)6-2/h5,7-13,15-18H,6,14H2,1-4H3/b8-5-,22-7+,24-18+ |
| InChIKey | YTGNKGCARSZZBF-KYNKDTLHSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|