C27H39FN2O2 — CID 142906646
3-[[6-[(Z)-3-aminoprop-1-enyl]-7-ethyl-2-fluoro-8,9-dihydro-5H-benzo[7]annulen-5-yl]methyl]-N-methylaniline;ethane;hydroperoxymethane (PubChem CID 142906646) has the molecular formula C27H39FN2O2 and a molecular weight of 442.62 g/mol. Its IUPAC name is 3-[[6-[(Z)-3-aminoprop-1-enyl]-7-ethyl-2-fluoro-8,9-dihydro-5H-benzo[7]annulen-5-yl]methyl]-N-methylaniline;ethane;hydroperoxymethane.
| Compound Name | 3-[[6-[(Z)-3-aminoprop-1-enyl]-7-ethyl-2-fluoro-8,9-dihydro-5H-benzo[7]annulen-5-yl]methyl]-N-methylaniline;ethane;hydroperoxymethane |
|---|---|
| PubChem CID | 142906646 |
| Molecular Formula | C27H39FN2O2 |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 3-[[6-[(Z)-3-aminoprop-1-enyl]-7-ethyl-2-fluoro-8,9-dihydro-5H-benzo[7]annulen-5-yl]methyl]-N-methylaniline;ethane;hydroperoxymethane |
| SMILES | CC.CCC1=C(/C=C\CN)C(Cc2cccc(NC)c2)c2ccc(F)cc2CC1.COO |
| InChI | InChI=1S/C24H29FN2.C2H6.CH4O2/c1-3-18-9-10-19-16-20(25)11-12-23(19)24(22(18)8-5-13-26)15-17-6-4-7-21(14-17)27-2;1-2;1-3-2/h4-8,11-12,14,16,24,27H,3,9-10,13,15,26H2,1-2H3;1-2H3;2H,1H3/b8-5-;; |
| InChIKey | CGUPHXZBJLGOIS-XTKZWJJBSA-N |
| XLogP | 6.49 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|