C24H24FNO2S — CID 70999185
N-[3-[(6-fluoro-13-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)methyl]phenyl]methanesulfonamide (PubChem CID 70999185) has the molecular formula C24H24FNO2S and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[3-[(6-fluoro-13-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(6-fluoro-13-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70999185 |
| Molecular Formula | C24H24FNO2S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[3-[(6-fluoro-13-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)methyl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc2c(c1)CCc1cc(F)ccc1C2Cc1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H24FNO2S/c1-16-6-10-22-18(12-16)7-8-19-15-20(25)9-11-23(19)24(22)14-17-4-3-5-21(13-17)26-29(2,27)28/h3-6,9-13,15,24,26H,7-8,14H2,1-2H3 |
| InChIKey | FONLVVJPZAVXES-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |