C24H21F2NO2S — CID 142906564
N-[3-[(3,3-difluoro-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenyl)methyl]phenyl]methanesulfonamide (PubChem CID 142906564) has the molecular formula C24H21F2NO2S and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[3-[(3,3-difluoro-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenyl)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(3,3-difluoro-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenyl)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 142906564 |
| Molecular Formula | C24H21F2NO2S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[3-[(3,3-difluoro-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenyl)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(CC2c3ccccc3C3C(c4ccccc42)C3(F)F)c1 |
| InChI | InChI=1S/C24H21F2NO2S/c1-30(28,29)27-16-8-6-7-15(13-16)14-21-17-9-2-4-11-19(17)22-23(24(22,25)26)20-12-5-3-10-18(20)21/h2-13,21-23,27H,14H2,1H3 |
| InChIKey | LLWWGQMNGJQSFG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |