C10H13F3N2O4S — CID 10495442
[3-(methanesulfonamido)phenyl]methylazanium;2,2,2-trifluoroacetate (PubChem CID 10495442) has the molecular formula C10H13F3N2O4S and a molecular weight of 314.29 g/mol. Its IUPAC name is [3-(methanesulfonamido)phenyl]methylazanium;2,2,2-trifluoroacetate.
| Compound Name | [3-(methanesulfonamido)phenyl]methylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10495442 |
| Molecular Formula | C10H13F3N2O4S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [3-(methanesulfonamido)phenyl]methylazanium;2,2,2-trifluoroacetate |
| SMILES | CS(=O)(=O)Nc1cccc(C[NH3+])c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H12N2O2S.C2HF3O2/c1-13(11,12)10-8-4-2-3-7(5-8)6-9;3-2(4,5)1(6)7/h2-5,10H,6,9H2,1H3;(H,6,7) |
| InChIKey | YEICMAYTPJYDOS-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |