C30H40O11 — CID 142907419
(2E,4Z)-2-ethyl-4,5-dimethoxyhepta-2,4,6-trienoic acid;2-(4-hydroxy-3,5-dimethoxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol;methoxymethane (PubChem CID 142907419) has the molecular formula C30H40O11 and a molecular weight of 576.64 g/mol. Its IUPAC name is (2E,4Z)-2-ethyl-4,5-dimethoxyhepta-2,4,6-trienoic acid;2-(4-hydroxy-3,5-dimethoxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol;methoxymethane.
| Compound Name | (2E,4Z)-2-ethyl-4,5-dimethoxyhepta-2,4,6-trienoic acid;2-(4-hydroxy-3,5-dimethoxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol;methoxymethane |
|---|---|
| PubChem CID | 142907419 |
| Molecular Formula | C30H40O11 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | (2E,4Z)-2-ethyl-4,5-dimethoxyhepta-2,4,6-trienoic acid;2-(4-hydroxy-3,5-dimethoxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol;methoxymethane |
| SMILES | C=C/C(OC)=C(\C=C(/CC)C(=O)O)OC.COC.COc1cc(C2CCc3c(O)cc(O)cc3O2)cc(OC)c1O |
| InChI | InChI=1S/C17H18O6.C11H16O4.C2H6O/c1-21-15-5-9(6-16(22-2)17(15)20)13-4-3-11-12(19)7-10(18)8-14(11)23-13;1-5-8(11(12)13)7-10(15-4)9(6-2)14-3;1-3-2/h5-8,13,18-20H,3-4H2,1-2H3;6-7H,2,5H2,1,3-4H3,(H,12,13);1-2H3/b;8-7+,10-9-; |
| InChIKey | IWMSRENFXCDWMA-ALUTUYFOSA-N |
| XLogP | 5.25 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|