C25H23F2NO12 — CID 166479689
[4-(5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)-2,6-dihydroxyphenyl] N-ethylcarbamate;fluoro 2-fluoro-3,4,5-trihydroxybenzoate (PubChem CID 166479689) has the molecular formula C25H23F2NO12 and a molecular weight of 567.45 g/mol. Its IUPAC name is [4-(5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)-2,6-dihydroxyphenyl] N-ethylcarbamate;fluoro 2-fluoro-3,4,5-trihydroxybenzoate.
| Compound Name | [4-(5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)-2,6-dihydroxyphenyl] N-ethylcarbamate;fluoro 2-fluoro-3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 166479689 |
| Molecular Formula | C25H23F2NO12 |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | [4-(5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl)-2,6-dihydroxyphenyl] N-ethylcarbamate;fluoro 2-fluoro-3,4,5-trihydroxybenzoate |
| SMILES | CCNC(=O)Oc1c(O)cc(C2CCc3c(O)cc(O)cc3O2)cc1O.O=C(OF)c1cc(O)c(O)c(O)c1F |
| InChI | InChI=1S/C18H19NO7.C7H4F2O5/c1-2-19-18(24)26-17-13(22)5-9(6-14(17)23)15-4-3-11-12(21)7-10(20)8-16(11)25-15;8-4-2(7(13)14-9)1-3(10)5(11)6(4)12/h5-8,15,20-23H,2-4H2,1H3,(H,19,24);1,10-12H |
| InChIKey | RBBWIZIFSCOKLP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 215.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|