C16H16F3N3S — CID 142908441
2-piperidin-1-yl-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 142908441) has the molecular formula C16H16F3N3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-piperidin-1-yl-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-piperidin-1-yl-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142908441 |
| Molecular Formula | C16H16F3N3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-piperidin-1-yl-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | C=C/C=C(\S)c1cc(C(F)(F)F)c(C#N)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H16F3N3S/c1-2-6-14(23)13-9-12(16(17,18)19)11(10-20)15(21-13)22-7-4-3-5-8-22/h2,6,9,23H,1,3-5,7-8H2/b14-6- |
| InChIKey | DWQOBNPFQSEONL-NSIKDUERSA-N |
| XLogP | 4.42 |
| TPSA | 39.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|