C14H9BrN2OS — CID 143568655
2-bromo-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile (PubChem CID 143568655) has the molecular formula C14H9BrN2OS and a molecular weight of 333.21 g/mol. Its IUPAC name is 2-bromo-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile.
| Compound Name | 2-bromo-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143568655 |
| Molecular Formula | C14H9BrN2OS |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 2-bromo-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile |
| SMILES | C=C/C=C(\S)c1cc(-c2ccco2)c(C#N)c(Br)n1 |
| InChI | InChI=1S/C14H9BrN2OS/c1-2-4-13(19)11-7-9(12-5-3-6-18-12)10(8-16)14(15)17-11/h2-7,19H,1H2/b13-4- |
| InChIKey | ZIXWBHVQEJTEHL-PQMHYQBVSA-N |
| XLogP | 4.43 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|