C12H9N3O2 — CID 134085841
5-cyano-4-(furan-2-yl)-6-methylpyridine-2-carboxamide (PubChem CID 134085841) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-cyano-4-(furan-2-yl)-6-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-4-(furan-2-yl)-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 134085841 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-cyano-4-(furan-2-yl)-6-methylpyridine-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)cc(-c2ccco2)c1C#N |
| InChI | InChI=1S/C12H9N3O2/c1-7-9(6-13)8(11-3-2-4-17-11)5-10(15-7)12(14)16/h2-5H,1H3,(H2,14,16) |
| InChIKey | DWMVGOYERDZULB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |