C22H18N2O4S — CID 15359410
ethyl 2-[[3-cyano-4-(furan-2-yl)-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate (PubChem CID 15359410) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 2-[[3-cyano-4-(furan-2-yl)-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[3-cyano-4-(furan-2-yl)-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 15359410 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | ethyl 2-[[3-cyano-4-(furan-2-yl)-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nc(-c2ccccc2)cc(-c2ccco2)c1C#N)C(C)=O |
| InChI | InChI=1S/C22H18N2O4S/c1-3-27-22(26)20(14(2)25)29-21-17(13-23)16(19-10-7-11-28-19)12-18(24-21)15-8-5-4-6-9-15/h4-12,20H,3H2,1-2H3 |
| InChIKey | XIIGBSBLZUMRAQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|