C17H10N4OS — CID 139219253
2-(cyanomethylsulfanyl)-4-(furan-2-yl)-6-pyridin-3-ylpyridine-3-carbonitrile (PubChem CID 139219253) has the molecular formula C17H10N4OS and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-4-(furan-2-yl)-6-pyridin-3-ylpyridine-3-carbonitrile.
| Compound Name | 2-(cyanomethylsulfanyl)-4-(furan-2-yl)-6-pyridin-3-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139219253 |
| Molecular Formula | C17H10N4OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-4-(furan-2-yl)-6-pyridin-3-ylpyridine-3-carbonitrile |
| SMILES | N#CCSc1nc(-c2cccnc2)cc(-c2ccco2)c1C#N |
| InChI | InChI=1S/C17H10N4OS/c18-5-8-23-17-14(10-19)13(16-4-2-7-22-16)9-15(21-17)12-3-1-6-20-11-12/h1-4,6-7,9,11H,8H2 |
| InChIKey | QAPVKEFAOMCJJP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |