C16H10N6OS2 — CID 143568430
4-(furan-2-yl)-2-(2H-tetrazol-5-ylmethylsulfanyl)-6-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 143568430) has the molecular formula C16H10N6OS2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-(furan-2-yl)-2-(2H-tetrazol-5-ylmethylsulfanyl)-6-thiophen-2-ylpyridine-3-carbonitrile.
| Compound Name | 4-(furan-2-yl)-2-(2H-tetrazol-5-ylmethylsulfanyl)-6-thiophen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143568430 |
| Molecular Formula | C16H10N6OS2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-(furan-2-yl)-2-(2H-tetrazol-5-ylmethylsulfanyl)-6-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccco2)cc(-c2cccs2)nc1SCc1nn[nH]n1 |
| InChI | InChI=1S/C16H10N6OS2/c17-8-11-10(13-3-1-5-23-13)7-12(14-4-2-6-24-14)18-16(11)25-9-15-19-21-22-20-15/h1-7H,9H2,(H,19,20,21,22) |
| InChIKey | IQWZAHZJDJHLHF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |