C21H13N3O2S — CID 143568670
2-(4-cyanophenoxy)-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile (PubChem CID 143568670) has the molecular formula C21H13N3O2S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile.
| Compound Name | 2-(4-cyanophenoxy)-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143568670 |
| Molecular Formula | C21H13N3O2S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-(4-cyanophenoxy)-4-(furan-2-yl)-6-[(1Z)-1-sulfanylbuta-1,3-dienyl]pyridine-3-carbonitrile |
| SMILES | C=C/C=C(\S)c1cc(-c2ccco2)c(C#N)c(Oc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C21H13N3O2S/c1-2-4-20(27)18-11-16(19-5-3-10-25-19)17(13-23)21(24-18)26-15-8-6-14(12-22)7-9-15/h2-11,27H,1H2/b20-4- |
| InChIKey | WLYPTZYPNJEKPC-YQLNASGTSA-N |
| XLogP | 5.33 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|