C21H30N2O2S — CID 142910503
ethane;N-(piperidin-4-ylmethyl)-N-prop-2-enylnaphthalene-1-sulfonamide (PubChem CID 142910503) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is ethane;N-(piperidin-4-ylmethyl)-N-prop-2-enylnaphthalene-1-sulfonamide.
| Compound Name | ethane;N-(piperidin-4-ylmethyl)-N-prop-2-enylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 142910503 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethane;N-(piperidin-4-ylmethyl)-N-prop-2-enylnaphthalene-1-sulfonamide |
| SMILES | C=CCN(CC1CCNCC1)S(=O)(=O)c1cccc2ccccc12.CC |
| InChI | InChI=1S/C19H24N2O2S.C2H6/c1-2-14-21(15-16-10-12-20-13-11-16)24(22,23)19-9-5-7-17-6-3-4-8-18(17)19;1-2/h2-9,16,20H,1,10-15H2;1-2H3 |
| InChIKey | MELDFWJKKRDUNI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|