C15H16N2O3S — CID 171054438
2-oxo-N,N-bis(prop-2-enyl)-1H-quinoline-8-sulfonamide (PubChem CID 171054438) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-oxo-N,N-bis(prop-2-enyl)-1H-quinoline-8-sulfonamide.
| Compound Name | 2-oxo-N,N-bis(prop-2-enyl)-1H-quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 171054438 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-oxo-N,N-bis(prop-2-enyl)-1H-quinoline-8-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1cccc2ccc(=O)[nH]c12 |
| InChI | InChI=1S/C15H16N2O3S/c1-3-10-17(11-4-2)21(19,20)13-7-5-6-12-8-9-14(18)16-15(12)13/h3-9H,1-2,10-11H2,(H,16,18) |
| InChIKey | SCHQJZHWOMDONP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|