About (2-oxo-1H-quinolin-8-yl) hydrogen sulfate
(2-oxo-1H-quinolin-8-yl) hydrogen sulfate (PubChem CID 156960910) has the molecular formula C9H7NO5S
and a molecular weight of 241.22 g/mol. Its IUPAC name is (2-oxo-1H-quinolin-8-yl) hydrogen sulfate.
Molecular Properties
| Compound Name | (2-oxo-1H-quinolin-8-yl) hydrogen sulfate |
| PubChem CID | 156960910 |
| Molecular Formula | C9H7NO5S |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | (2-oxo-1H-quinolin-8-yl) hydrogen sulfate |
| SMILES | O=c1ccc2cccc(OS(=O)(=O)O)c2[nH]1 |
| InChI | InChI=1S/C9H7NO5S/c11-8-5-4-6-2-1-3-7(9(6)10-8)15-16(12,13)14/h1-5H,(H,10,11)(H,12,13,14) |
| InChIKey | ZLYUIVZAQHFCNP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1H-quinolin-8-yl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1H-quinolin-8-yl) hydrogen sulfate?
The IUPAC name of (2-oxo-1H-quinolin-8-yl) hydrogen sulfate (CID 156960910) is (2-oxo-1H-quinolin-8-yl) hydrogen sulfate.
What is the SMILES notation for (2-oxo-1H-quinolin-8-yl) hydrogen sulfate?
The canonical SMILES for (2-oxo-1H-quinolin-8-yl) hydrogen sulfate is O=c1ccc2cccc(OS(=O)(=O)O)c2[nH]1.
What is the InChIKey of (2-oxo-1H-quinolin-8-yl) hydrogen sulfate?
The InChIKey is ZLYUIVZAQHFCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO5S/c11-8-5-4-6-2-1-3-7(9(6)10-8)15-16(12,13)14/h1-5H,(H,10,11)(H,12,13,14).
What are the key properties of (2-oxo-1H-quinolin-8-yl) hydrogen sulfate?
(2-oxo-1H-quinolin-8-yl) hydrogen sulfate has a molecular weight of 241.22 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1H-quinolin-8-yl) hydrogen sulfate is sourced from PubChem (CID 156960910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).