C27H27NO2S — CID 142911947
[2-[(3-methylsulfanylphenyl)methylamino]-5-prop-2-ynoxyphenyl]-(4-propan-2-ylphenyl)methanone (PubChem CID 142911947) has the molecular formula C27H27NO2S and a molecular weight of 429.59 g/mol. Its IUPAC name is [2-[(3-methylsulfanylphenyl)methylamino]-5-prop-2-ynoxyphenyl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [2-[(3-methylsulfanylphenyl)methylamino]-5-prop-2-ynoxyphenyl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 142911947 |
| Molecular Formula | C27H27NO2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [2-[(3-methylsulfanylphenyl)methylamino]-5-prop-2-ynoxyphenyl]-(4-propan-2-ylphenyl)methanone |
| SMILES | C#CCOc1ccc(NCc2cccc(SC)c2)c(C(=O)c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C27H27NO2S/c1-5-15-30-23-13-14-26(28-18-20-7-6-8-24(16-20)31-4)25(17-23)27(29)22-11-9-21(10-12-22)19(2)3/h1,6-14,16-17,19,28H,15,18H2,2-4H3 |
| InChIKey | CBGSBJCVOHOOEW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|