C26H41NO2 — CID 142912505
2-tert-butyl-6-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]phenol;propane (PubChem CID 142912505) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]phenol;propane.
| Compound Name | 2-tert-butyl-6-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]phenol;propane |
|---|---|
| PubChem CID | 142912505 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | 2-tert-butyl-6-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]phenol;propane |
| SMILES | CCC.CCN(CC)CCOc1ccccc1Cc1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H33NO2.C3H8/c1-6-24(7-2)15-16-26-21-14-9-8-11-18(21)17-19-12-10-13-20(22(19)25)23(3,4)5;1-3-2/h8-14,25H,6-7,15-17H2,1-5H3;3H2,1-2H3 |
| InChIKey | ZYIABKXHRJHQQY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |