C10H22N4O3 — CID 142912677
tert-butyl N-methyl-N-[2-(methylaminocarbamoylamino)ethyl]carbamate (PubChem CID 142912677) has the molecular formula C10H22N4O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-(methylaminocarbamoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-(methylaminocarbamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 142912677 |
| Molecular Formula | C10H22N4O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | tert-butyl N-methyl-N-[2-(methylaminocarbamoylamino)ethyl]carbamate |
| SMILES | CNNC(=O)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N4O3/c1-10(2,3)17-9(16)14(5)7-6-12-8(15)13-11-4/h11H,6-7H2,1-5H3,(H2,12,13,15) |
| InChIKey | CTUYDBOODRNFJI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|