C18H26ClN3O4 — CID 142918368
tert-butyl N-[3-(4-chloro-2-hydroxyphenyl)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate (PubChem CID 142918368) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-2-hydroxyphenyl)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-2-hydroxyphenyl)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 142918368 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-2-hydroxyphenyl)-1-oxo-1-piperazin-1-ylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(Cl)cc1O)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C18H26ClN3O4/c1-18(2,3)26-17(25)21-14(16(24)22-8-6-20-7-9-22)10-12-4-5-13(19)11-15(12)23/h4-5,11,14,20,23H,6-10H2,1-3H3,(H,21,25) |
| InChIKey | NAUJSXUSIJYKHO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |