C19H23F5N2O6S — CID 162587727
[3-fluoro-4-[(2S)-3-(3-fluoropyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate (PubChem CID 162587727) has the molecular formula C19H23F5N2O6S and a molecular weight of 502.46 g/mol. Its IUPAC name is [3-fluoro-4-[(2S)-3-(3-fluoropyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-fluoro-4-[(2S)-3-(3-fluoropyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162587727 |
| Molecular Formula | C19H23F5N2O6S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | [3-fluoro-4-[(2S)-3-(3-fluoropyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1F)C(=O)N1CCC(F)C1 |
| InChI | InChI=1S/C19H23F5N2O6S/c1-18(2,3)31-17(28)25-15(16(27)26-7-6-12(20)10-26)8-11-4-5-13(9-14(11)21)32-33(29,30)19(22,23)24/h4-5,9,12,15H,6-8,10H2,1-3H3,(H,25,28)/t12?,15-/m0/s1 |
| InChIKey | LDIQTWDZOPECPA-CVRLYYSRSA-N |
| XLogP | 3.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|