C18H22F4N2O6S — CID 86663509
[4-[2-[(3S)-3-fluoropyrrolidin-1-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]phenyl] trifluoromethanesulfonate (PubChem CID 86663509) has the molecular formula C18H22F4N2O6S and a molecular weight of 470.44 g/mol. Its IUPAC name is [4-[2-[(3S)-3-fluoropyrrolidin-1-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[2-[(3S)-3-fluoropyrrolidin-1-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86663509 |
| Molecular Formula | C18H22F4N2O6S |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [4-[2-[(3S)-3-fluoropyrrolidin-1-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)N1CC[C@H](F)C1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F4N2O6S/c1-17(2,3)29-16(26)23-14(15(25)24-9-8-12(19)10-24)11-4-6-13(7-5-11)30-31(27,28)18(20,21)22/h4-7,12,14H,8-10H2,1-3H3,(H,23,26)/t12-,14?/m0/s1 |
| InChIKey | OKPMIJHNBMZSRC-NBFOIZRFSA-N |
| XLogP | 3.05 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|