C21H28BrFN2O3 — CID 69345864
tert-butyl N-[(E,2S,3S)-3-(4-bromophenyl)-1-(3-fluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate (PubChem CID 69345864) has the molecular formula C21H28BrFN2O3 and a molecular weight of 455.37 g/mol. Its IUPAC name is tert-butyl N-[(E,2S,3S)-3-(4-bromophenyl)-1-(3-fluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S,3S)-3-(4-bromophenyl)-1-(3-fluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 69345864 |
| Molecular Formula | C21H28BrFN2O3 |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | tert-butyl N-[(E,2S,3S)-3-(4-bromophenyl)-1-(3-fluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate |
| SMILES | C/C=C/[C@@H](c1ccc(Br)cc1)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC(F)C1 |
| InChI | InChI=1S/C21H28BrFN2O3/c1-5-6-17(14-7-9-15(22)10-8-14)18(24-20(27)28-21(2,3)4)19(26)25-12-11-16(23)13-25/h5-10,16-18H,11-13H2,1-4H3,(H,24,27)/b6-5+/t16?,17-,18-/m0/s1 |
| InChIKey | RNBRBEMOHXZFNB-KZLYHARASA-N |
| XLogP | 4.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|