About 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol
1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol (PubChem CID 14291994) has the molecular formula C12H16F2O3S
and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol |
| PubChem CID | 14291994 |
| Molecular Formula | C12H16F2O3S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16F2O3S/c1-11(2,3)10(15)12(13,14)18(16,17)9-7-5-4-6-8-9/h4-8,10,15H,1-3H3 |
| InChIKey | NBBXOCALLDQUHU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol?
The IUPAC name of 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol (CID 14291994) is 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol.
What is the SMILES notation for 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol?
The canonical SMILES for 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol is CC(C)(C)C(O)C(F)(F)S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol?
The InChIKey is NBBXOCALLDQUHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O3S/c1-11(2,3)10(15)12(13,14)18(16,17)9-7-5-4-6-8-9/h4-8,10,15H,1-3H3.
What are the key properties of 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol?
1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol has a molecular weight of 278.32 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-1,1-difluoro-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 14291994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).