C30H37N3O2S — CID 142922018
4-[(3-acetamidophenyl)-[1-[(Z)-2-methylidene-4-sulfanylbut-3-enyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide (PubChem CID 142922018) has the molecular formula C30H37N3O2S and a molecular weight of 503.71 g/mol. Its IUPAC name is 4-[(3-acetamidophenyl)-[1-[(Z)-2-methylidene-4-sulfanylbut-3-enyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(3-acetamidophenyl)-[1-[(Z)-2-methylidene-4-sulfanylbut-3-enyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 142922018 |
| Molecular Formula | C30H37N3O2S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 4-[(3-acetamidophenyl)-[1-[(Z)-2-methylidene-4-sulfanylbut-3-enyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide |
| SMILES | C=C(/C=C\S)CN1CCC(=C(c2ccc(C(=O)N(CC)CC)cc2)c2cccc(NC(C)=O)c2)CC1 |
| InChI | InChI=1S/C30H37N3O2S/c1-5-33(6-2)30(35)26-12-10-24(11-13-26)29(27-8-7-9-28(20-27)31-23(4)34)25-14-17-32(18-15-25)21-22(3)16-19-36/h7-13,16,19-20,36H,3,5-6,14-15,17-18,21H2,1-2,4H3,(H,31,34)/b19-16- |
| InChIKey | RYZZAVHJDDTZSU-MNDPQUGUSA-N |
| XLogP | 6.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|