C13H13F3N2O5 — CID 142923818
N,3-dihydroxy-5-[4-methoxy-3-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 142923818) has the molecular formula C13H13F3N2O5 and a molecular weight of 334.25 g/mol. Its IUPAC name is N,3-dihydroxy-5-[4-methoxy-3-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | N,3-dihydroxy-5-[4-methoxy-3-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 142923818 |
| Molecular Formula | C13H13F3N2O5 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N,3-dihydroxy-5-[4-methoxy-3-(trifluoromethoxy)phenyl]-2,3-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | COc1ccc(C2=CC(O)C(C(=O)NO)N2)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O5/c1-22-9-3-2-6(4-10(9)23-13(14,15)16)7-5-8(19)11(17-7)12(20)18-21/h2-5,8,11,17,19,21H,1H3,(H,18,20) |
| InChIKey | VEYOEVCTXNFUCN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|