C11H15IN4O5S — CID 142924320
2-(1,1-dioxothiazinan-2-yl)-5-hydroxy-N-(iodomethyl)-1-methyl-6-oxopyrimidine-4-carboxamide (PubChem CID 142924320) has the molecular formula C11H15IN4O5S and a molecular weight of 442.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiazinan-2-yl)-5-hydroxy-N-(iodomethyl)-1-methyl-6-oxopyrimidine-4-carboxamide.
| Compound Name | 2-(1,1-dioxothiazinan-2-yl)-5-hydroxy-N-(iodomethyl)-1-methyl-6-oxopyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 142924320 |
| Molecular Formula | C11H15IN4O5S |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 2-(1,1-dioxothiazinan-2-yl)-5-hydroxy-N-(iodomethyl)-1-methyl-6-oxopyrimidine-4-carboxamide |
| SMILES | Cn1c(N2CCCCS2(=O)=O)nc(C(=O)NCI)c(O)c1=O |
| InChI | InChI=1S/C11H15IN4O5S/c1-15-10(19)8(17)7(9(18)13-6-12)14-11(15)16-4-2-3-5-22(16,20)21/h17H,2-6H2,1H3,(H,13,18) |
| InChIKey | VZZAQBDAKYFGTG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|