About 4-chloro-N-methylaniline;propanal
4-chloro-N-methylaniline;propanal (PubChem CID 142927020) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is 4-chloro-N-methylaniline;propanal.
Molecular Properties
| Compound Name | 4-chloro-N-methylaniline;propanal |
| PubChem CID | 142927020 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-chloro-N-methylaniline;propanal |
| SMILES | CCC=O.CNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H8ClN.C3H6O/c1-9-7-4-2-6(8)3-5-7;1-2-3-4/h2-5,9H,1H3;3H,2H2,1H3 |
| InChIKey | RHJZPCVREYWNBG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-methylaniline;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-methylaniline;propanal?
The IUPAC name of 4-chloro-N-methylaniline;propanal (CID 142927020) is 4-chloro-N-methylaniline;propanal.
What is the SMILES notation for 4-chloro-N-methylaniline;propanal?
The canonical SMILES for 4-chloro-N-methylaniline;propanal is CCC=O.CNc1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-methylaniline;propanal?
The InChIKey is RHJZPCVREYWNBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.C3H6O/c1-9-7-4-2-6(8)3-5-7;1-2-3-4/h2-5,9H,1H3;3H,2H2,1H3.
What are the key properties of 4-chloro-N-methylaniline;propanal?
4-chloro-N-methylaniline;propanal has a molecular weight of 199.68 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-methylaniline;propanal is sourced from PubChem (CID 142927020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).