C23H25F2NO4 — CID 142927219
4-[[4-[(2E,5E)-6-(difluoromethoxy)octa-2,5,7-trien-2-yl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 142927219) has the molecular formula C23H25F2NO4 and a molecular weight of 417.45 g/mol. Its IUPAC name is 4-[[4-[(2E,5E)-6-(difluoromethoxy)octa-2,5,7-trien-2-yl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[[4-[(2E,5E)-6-(difluoromethoxy)octa-2,5,7-trien-2-yl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 142927219 |
| Molecular Formula | C23H25F2NO4 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[[4-[(2E,5E)-6-(difluoromethoxy)octa-2,5,7-trien-2-yl]-N-methylanilino]methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | C=C/C(=C\C/C=C(\C)c1ccc(N(C)Cc2cc(C(=O)O)oc2C)cc1)OC(F)F |
| InChI | InChI=1S/C23H25F2NO4/c1-5-20(30-23(24)25)8-6-7-15(2)17-9-11-19(12-10-17)26(4)14-18-13-21(22(27)28)29-16(18)3/h5,7-13,23H,1,6,14H2,2-4H3,(H,27,28)/b15-7+,20-8+ |
| InChIKey | APOMBSDOHUUTQC-ZTJKHUJPSA-N |
| XLogP | 6.03 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|