C13H20N2S — CID 142927412
ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-1H-pyrimidine-4-thione (PubChem CID 142927412) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 142927412 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | ethane;2-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-1H-pyrimidine-4-thione |
| SMILES | C/C=C\C(=C/C)c1nc(=S)cc(C)[nH]1.CC |
| InChI | InChI=1S/C11H14N2S.C2H6/c1-4-6-9(5-2)11-12-8(3)7-10(14)13-11;1-2/h4-7H,1-3H3,(H,12,13,14);1-2H3/b6-4-,9-5+; |
| InChIKey | GHBMMINWCKGBQF-AFPQSWDMSA-N |
| XLogP | 4.45 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|