About 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole
1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole (PubChem CID 142928655) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole.
Molecular Properties
| Compound Name | 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole |
| PubChem CID | 142928655 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole |
| SMILES | CC1C=CC=C(c2cn(C)c3ccccc23)C=C1 |
| InChI | InChI=1S/C17H17N/c1-13-6-5-7-14(11-10-13)16-12-18(2)17-9-4-3-8-15(16)17/h3-13H,1-2H3 |
| InChIKey | UWYKAUSSPDMCFP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole?
The IUPAC name of 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole (CID 142928655) is 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole.
What is the SMILES notation for 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole?
The canonical SMILES for 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole is CC1C=CC=C(c2cn(C)c3ccccc23)C=C1.
What is the InChIKey of 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole?
The InChIKey is UWYKAUSSPDMCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-13-6-5-7-14(11-10-13)16-12-18(2)17-9-4-3-8-15(16)17/h3-13H,1-2H3.
What are the key properties of 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole?
1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole has a molecular weight of 235.33 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(5-methylcyclohepta-1,3,6-trien-1-yl)indole is sourced from PubChem (CID 142928655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).