C13H13N5 — CID 15211774
4-methyl-6-(1-methylindol-3-yl)-1,3,5-triazin-2-amine (PubChem CID 15211774) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-methyl-6-(1-methylindol-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-methyl-6-(1-methylindol-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 15211774 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-methyl-6-(1-methylindol-3-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(N)nc(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C13H13N5/c1-8-15-12(17-13(14)16-8)10-7-18(2)11-6-4-3-5-9(10)11/h3-7H,1-2H3,(H2,14,15,16,17) |
| InChIKey | AAAHVLFJWDSDHF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |