C12H12N4 — CID 147456489
1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indole (PubChem CID 147456489) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indole.
| Compound Name | 1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indole |
|---|---|
| PubChem CID | 147456489 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-methyl-3-(5-methyl-1H-1,2,4-triazol-3-yl)indole |
| SMILES | Cc1nc(-c2cn(C)c3ccccc23)n[nH]1 |
| InChI | InChI=1S/C12H12N4/c1-8-13-12(15-14-8)10-7-16(2)11-6-4-3-5-9(10)11/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | DZBXOPMEKUVOSU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |