C12H9F3N4 — CID 167905010
1-methyl-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]indole (PubChem CID 167905010) has the molecular formula C12H9F3N4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-methyl-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]indole.
| Compound Name | 1-methyl-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]indole |
|---|---|
| PubChem CID | 167905010 |
| Molecular Formula | C12H9F3N4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-methyl-3-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]indole |
| SMILES | Cn1cc(-c2n[nH]c(C(F)(F)F)n2)c2ccccc21 |
| InChI | InChI=1S/C12H9F3N4/c1-19-6-8(7-4-2-3-5-9(7)19)10-16-11(18-17-10)12(13,14)15/h2-6H,1H3,(H,16,17,18) |
| InChIKey | RWTKRRYXXZZBJT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |