C16H14N4 — CID 153412768
2-methyl-4-(1-methylindol-3-yl)-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 153412768) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-methyl-4-(1-methylindol-3-yl)-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 2-methyl-4-(1-methylindol-3-yl)-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 153412768 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-methyl-4-(1-methylindol-3-yl)-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(-c2cn(C)c3ccccc23)c2[nH]ccc2n1 |
| InChI | InChI=1S/C16H14N4/c1-10-18-13-7-8-17-16(13)15(19-10)12-9-20(2)14-6-4-3-5-11(12)14/h3-9,17H,1-2H3 |
| InChIKey | COSBNAGPMUWONK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |