C17H18O3 — CID 142928945
2-(2-methyl-4-phenacylcyclohexa-1,5-dien-1-yl)acetic acid (PubChem CID 142928945) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2-methyl-4-phenacylcyclohexa-1,5-dien-1-yl)acetic acid.
| Compound Name | 2-(2-methyl-4-phenacylcyclohexa-1,5-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 142928945 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(2-methyl-4-phenacylcyclohexa-1,5-dien-1-yl)acetic acid |
| SMILES | CC1=C(CC(=O)O)C=CC(CC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H18O3/c1-12-9-13(7-8-15(12)11-17(19)20)10-16(18)14-5-3-2-4-6-14/h2-8,13H,9-11H2,1H3,(H,19,20) |
| InChIKey | AZJPLIBHJHGUBQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |