C13H13NO — CID 143835496
2-(3,4-dihydropyridin-4-yl)-1-phenylethanone (PubChem CID 143835496) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(3,4-dihydropyridin-4-yl)-1-phenylethanone.
| Compound Name | 2-(3,4-dihydropyridin-4-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 143835496 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(3,4-dihydropyridin-4-yl)-1-phenylethanone |
| SMILES | O=C(CC1C=CN=CC1)c1ccccc1 |
| InChI | InChI=1S/C13H13NO/c15-13(12-4-2-1-3-5-12)10-11-6-8-14-9-7-11/h1-6,8-9,11H,7,10H2 |
| InChIKey | OCEZHXPFSHWEEZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |