C22H28 — CID 142929986
1,4-dimethyl-2-(1-phenyl-2-propylpent-1-enyl)benzene (PubChem CID 142929986) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1,4-dimethyl-2-(1-phenyl-2-propylpent-1-enyl)benzene.
| Compound Name | 1,4-dimethyl-2-(1-phenyl-2-propylpent-1-enyl)benzene |
|---|---|
| PubChem CID | 142929986 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1,4-dimethyl-2-(1-phenyl-2-propylpent-1-enyl)benzene |
| SMILES | CCCC(CCC)=C(c1ccccc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C22H28/c1-5-10-19(11-6-2)22(20-12-8-7-9-13-20)21-16-17(3)14-15-18(21)4/h7-9,12-16H,5-6,10-11H2,1-4H3 |
| InChIKey | FVGYIBXCZMTKCX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |