C29H34F3N3O4 — CID 142930114
methyl 3-[[4-[[5-heptan-2-yl-3-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]propanoate (PubChem CID 142930114) has the molecular formula C29H34F3N3O4 and a molecular weight of 545.60 g/mol. Its IUPAC name is methyl 3-[[4-[[5-heptan-2-yl-3-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[[5-heptan-2-yl-3-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 142930114 |
| Molecular Formula | C29H34F3N3O4 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | methyl 3-[[4-[[5-heptan-2-yl-3-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]propanoate |
| SMILES | CCCCCC(C)c1cc(-c2ccc(OC(F)(F)F)cc2)nn1Cc1ccc(C(=O)NCCC(=O)OC)cc1 |
| InChI | InChI=1S/C29H34F3N3O4/c1-4-5-6-7-20(2)26-18-25(22-12-14-24(15-13-22)39-29(30,31)32)34-35(26)19-21-8-10-23(11-9-21)28(37)33-17-16-27(36)38-3/h8-15,18,20H,4-7,16-17,19H2,1-3H3,(H,33,37) |
| InChIKey | OXHOJEHQEGUUBS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|