C27H42N4O3 — CID 142930555
formaldehyde;N-[3-[4-[4-(methylamino)butyl]piperazin-1-yl]phenyl]acetamide;1,4-xylene (PubChem CID 142930555) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is formaldehyde;N-[3-[4-[4-(methylamino)butyl]piperazin-1-yl]phenyl]acetamide;1,4-xylene.
| Compound Name | formaldehyde;N-[3-[4-[4-(methylamino)butyl]piperazin-1-yl]phenyl]acetamide;1,4-xylene |
|---|---|
| PubChem CID | 142930555 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | formaldehyde;N-[3-[4-[4-(methylamino)butyl]piperazin-1-yl]phenyl]acetamide;1,4-xylene |
| SMILES | C=O.C=O.CNCCCCN1CCN(c2cccc(NC(C)=O)c2)CC1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C17H28N4O.C8H10.2CH2O/c1-15(22)19-16-6-5-7-17(14-16)21-12-10-20(11-13-21)9-4-3-8-18-2;1-7-3-5-8(2)6-4-7;2*1-2/h5-7,14,18H,3-4,8-13H2,1-2H3,(H,19,22);3-6H,1-2H3;2*1H2 |
| InChIKey | SAQXCEGFYDLCHV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|