C26H37N4O3S- — CID 67013257
1-[3-(2,2-dimethylpropanoylamino)phenyl]-4-[4-(4-methyl-N-sulfinatoanilino)butyl]piperazine (PubChem CID 67013257) has the molecular formula C26H37N4O3S- and a molecular weight of 485.67 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylpropanoylamino)phenyl]-4-[4-(4-methyl-N-sulfinatoanilino)butyl]piperazine.
| Compound Name | 1-[3-(2,2-dimethylpropanoylamino)phenyl]-4-[4-(4-methyl-N-sulfinatoanilino)butyl]piperazine |
|---|---|
| PubChem CID | 67013257 |
| Molecular Formula | C26H37N4O3S- |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 1-[3-(2,2-dimethylpropanoylamino)phenyl]-4-[4-(4-methyl-N-sulfinatoanilino)butyl]piperazine |
| SMILES | Cc1ccc(N(CCCCN2CCN(c3cccc(NC(=O)C(C)(C)C)c3)CC2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C26H38N4O3S/c1-21-10-12-23(13-11-21)30(34(32)33)15-6-5-14-28-16-18-29(19-17-28)24-9-7-8-22(20-24)27-25(31)26(2,3)4/h7-13,20H,5-6,14-19H2,1-4H3,(H,27,31)(H,32,33)/p-1 |
| InChIKey | JFGNCMIOLBXSCX-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|