C27H36F3N3O2 — CID 142931076
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-[(5E)-7,7,7-trifluoro-3-methylhepta-1,5-dien-4-yl]furan-2-carboxamide;ethane (PubChem CID 142931076) has the molecular formula C27H36F3N3O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-[(5E)-7,7,7-trifluoro-3-methylhepta-1,5-dien-4-yl]furan-2-carboxamide;ethane.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-[(5E)-7,7,7-trifluoro-3-methylhepta-1,5-dien-4-yl]furan-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142931076 |
| Molecular Formula | C27H36F3N3O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-[(5E)-7,7,7-trifluoro-3-methylhepta-1,5-dien-4-yl]furan-2-carboxamide;ethane |
| SMILES | C=CC(C)C(/C=C/C(F)(F)F)c1ccc(C(=O)Nc2ccc(N3CCC(N(C)C)C3)cc2)o1.CC |
| InChI | InChI=1S/C25H30F3N3O2.C2H6/c1-5-17(2)21(12-14-25(26,27)28)22-10-11-23(33-22)24(32)29-18-6-8-19(9-7-18)31-15-13-20(16-31)30(3)4;1-2/h5-12,14,17,20-21H,1,13,15-16H2,2-4H3,(H,29,32);1-2H3/b14-12+; |
| InChIKey | YZLZIPUDFKIXCQ-UNGNXWFZSA-N |
| XLogP | 6.72 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|