C31H34FN3O4 — CID 142932013
N-ethyl-5-[5-[2-(4-fluorophenyl)ethyl]-2,4-dihydroxyphenyl]-4-[4-(pentylamino)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 142932013) has the molecular formula C31H34FN3O4 and a molecular weight of 531.63 g/mol. Its IUPAC name is N-ethyl-5-[5-[2-(4-fluorophenyl)ethyl]-2,4-dihydroxyphenyl]-4-[4-(pentylamino)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-ethyl-5-[5-[2-(4-fluorophenyl)ethyl]-2,4-dihydroxyphenyl]-4-[4-(pentylamino)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 142932013 |
| Molecular Formula | C31H34FN3O4 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-ethyl-5-[5-[2-(4-fluorophenyl)ethyl]-2,4-dihydroxyphenyl]-4-[4-(pentylamino)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCNc1ccc(-c2c(C(=O)NCC)noc2-c2cc(CCc3ccc(F)cc3)c(O)cc2O)cc1 |
| InChI | InChI=1S/C31H34FN3O4/c1-3-5-6-17-34-24-15-11-21(12-16-24)28-29(31(38)33-4-2)35-39-30(28)25-18-22(26(36)19-27(25)37)10-7-20-8-13-23(32)14-9-20/h8-9,11-16,18-19,34,36-37H,3-7,10,17H2,1-2H3,(H,33,38) |
| InChIKey | DMWWHDDPSQWSKT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|