C22H24BNO3 — CID 142932950
2-[4-methoxy-3-(naphthalen-1-ylmethyl)phenyl]-4,5,5-trimethyl-1,3,4,2-dioxazaborolidine (PubChem CID 142932950) has the molecular formula C22H24BNO3 and a molecular weight of 361.25 g/mol. Its IUPAC name is 2-[4-methoxy-3-(naphthalen-1-ylmethyl)phenyl]-4,5,5-trimethyl-1,3,4,2-dioxazaborolidine.
| Compound Name | 2-[4-methoxy-3-(naphthalen-1-ylmethyl)phenyl]-4,5,5-trimethyl-1,3,4,2-dioxazaborolidine |
|---|---|
| PubChem CID | 142932950 |
| Molecular Formula | C22H24BNO3 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[4-methoxy-3-(naphthalen-1-ylmethyl)phenyl]-4,5,5-trimethyl-1,3,4,2-dioxazaborolidine |
| SMILES | COc1ccc(B2ON(C)C(C)(C)O2)cc1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H24BNO3/c1-22(2)24(3)27-23(26-22)19-12-13-21(25-4)18(15-19)14-17-10-7-9-16-8-5-6-11-20(16)17/h5-13,15H,14H2,1-4H3 |
| InChIKey | YUVBFOLMNXCPJD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|