C10H16N2 — CID 142933427
2,3-bis(ethenyl)-4H-pyrimidine;ethane (PubChem CID 142933427) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4H-pyrimidine;ethane.
| Compound Name | 2,3-bis(ethenyl)-4H-pyrimidine;ethane |
|---|---|
| PubChem CID | 142933427 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2,3-bis(ethenyl)-4H-pyrimidine;ethane |
| SMILES | C=CC1=NC=CCN1C=C.CC |
| InChI | InChI=1S/C8H10N2.C2H6/c1-3-8-9-6-5-7-10(8)4-2;1-2/h3-6H,1-2,7H2;1-2H3 |
| InChIKey | KUFWCJFZPBRJTF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |