C19H25FN6O — CID 142934728
6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide (PubChem CID 142934728) has the molecular formula C19H25FN6O and a molecular weight of 372.45 g/mol. Its IUPAC name is 6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142934728 |
| Molecular Formula | C19H25FN6O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide |
| SMILES | C=N/C(CN(CC(C)C)C(=O)c1cccc(F)n1)=C(/CCC)c1ncn[nH]1 |
| InChI | InChI=1S/C19H25FN6O/c1-5-7-14(18-22-12-23-25-18)16(21-4)11-26(10-13(2)3)19(27)15-8-6-9-17(20)24-15/h6,8-9,12-13H,4-5,7,10-11H2,1-3H3,(H,22,23,25)/b16-14- |
| InChIKey | CNIZGUGOMORPKV-PEZBUJJGSA-N |
| XLogP | 3.35 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|