C19H26F2N4OS — CID 142935002
acetylene;(3E,6Z)-1-[4-amino-2-[(1-methylpiperidin-4-yl)amino]-1,3-thiazol-5-yl]-3,8-difluoroocta-3,6-dien-1-one (PubChem CID 142935002) has the molecular formula C19H26F2N4OS and a molecular weight of 396.51 g/mol. Its IUPAC name is acetylene;(3E,6Z)-1-[4-amino-2-[(1-methylpiperidin-4-yl)amino]-1,3-thiazol-5-yl]-3,8-difluoroocta-3,6-dien-1-one.
| Compound Name | acetylene;(3E,6Z)-1-[4-amino-2-[(1-methylpiperidin-4-yl)amino]-1,3-thiazol-5-yl]-3,8-difluoroocta-3,6-dien-1-one |
|---|---|
| PubChem CID | 142935002 |
| Molecular Formula | C19H26F2N4OS |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | acetylene;(3E,6Z)-1-[4-amino-2-[(1-methylpiperidin-4-yl)amino]-1,3-thiazol-5-yl]-3,8-difluoroocta-3,6-dien-1-one |
| SMILES | C#C.CN1CCC(Nc2nc(N)c(C(=O)C/C(F)=C\C/C=C\CF)s2)CC1 |
| InChI | InChI=1S/C17H24F2N4OS.C2H2/c1-23-9-6-13(7-10-23)21-17-22-16(20)15(25-17)14(24)11-12(19)5-3-2-4-8-18;1-2/h2,4-5,13H,3,6-11,20H2,1H3,(H,21,22);1-2H/b4-2-,12-5+; |
| InChIKey | CZIYAQSOKRGEJP-USDKZMRISA-N |
| XLogP | 3.82 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|