C10H23N3O — CID 142935970
N-[(E)-3-aminopropylideneamino]-2,2-dimethylpropanamide;ethane (PubChem CID 142935970) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[(E)-3-aminopropylideneamino]-2,2-dimethylpropanamide;ethane.
| Compound Name | N-[(E)-3-aminopropylideneamino]-2,2-dimethylpropanamide;ethane |
|---|---|
| PubChem CID | 142935970 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | N-[(E)-3-aminopropylideneamino]-2,2-dimethylpropanamide;ethane |
| SMILES | CC.CC(C)(C)C(=O)N/N=C/CCN |
| InChI | InChI=1S/C8H17N3O.C2H6/c1-8(2,3)7(12)11-10-6-4-5-9;1-2/h6H,4-5,9H2,1-3H3,(H,11,12);1-2H3/b10-6+; |
| InChIKey | GVWUCUZGEIPJEC-AAGWESIMSA-N |
| XLogP | 1.51 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|